C11H15NO2 — CID 122674877
(3S,4R)-3-amino-4-hydroxy-4-phenylpentan-2-one (PubChem CID 122674877) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-hydroxy-4-phenylpentan-2-one.
| Compound Name | (3S,4R)-3-amino-4-hydroxy-4-phenylpentan-2-one |
|---|---|
| PubChem CID | 122674877 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3S,4R)-3-amino-4-hydroxy-4-phenylpentan-2-one |
| SMILES | CC(=O)[C@@H](N)[C@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-8(13)10(12)11(2,14)9-6-4-3-5-7-9/h3-7,10,14H,12H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | PXJOKMGISGIHPC-GHMZBOCLSA-N |
| XLogP | 0.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |