C13H18O2 — CID 13299690
(4R,5R)-5-hydroxy-4-methyl-5-phenylhexan-3-one (PubChem CID 13299690) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (4R,5R)-5-hydroxy-4-methyl-5-phenylhexan-3-one.
| Compound Name | (4R,5R)-5-hydroxy-4-methyl-5-phenylhexan-3-one |
|---|---|
| PubChem CID | 13299690 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4R,5R)-5-hydroxy-4-methyl-5-phenylhexan-3-one |
| SMILES | CCC(=O)[C@H](C)[C@@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-4-12(14)10(2)13(3,15)11-8-6-5-7-9-11/h5-10,15H,4H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | UWMMLVJAFQGRTC-GXFFZTMASA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |