C24H32O3 — CID 159710699
2,3-dimethyl-3-phenylbutanoic acid;2-methyl-2-phenylpentan-3-one (PubChem CID 159710699) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2,3-dimethyl-3-phenylbutanoic acid;2-methyl-2-phenylpentan-3-one.
| Compound Name | 2,3-dimethyl-3-phenylbutanoic acid;2-methyl-2-phenylpentan-3-one |
|---|---|
| PubChem CID | 159710699 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2,3-dimethyl-3-phenylbutanoic acid;2-methyl-2-phenylpentan-3-one |
| SMILES | CC(C(=O)O)C(C)(C)c1ccccc1.CCC(=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C12H16O2.C12H16O/c1-9(11(13)14)12(2,3)10-7-5-4-6-8-10;1-4-11(13)12(2,3)10-8-6-5-7-9-10/h4-9H,1-3H3,(H,13,14);5-9H,4H2,1-3H3 |
| InChIKey | MYUJVQVQBFWJFP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |