C21H20 — CID 155685834
(3,5-dimethylidene-4-phenylhepta-1,6-dien-4-yl)benzene (PubChem CID 155685834) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is (3,5-dimethylidene-4-phenylhepta-1,6-dien-4-yl)benzene.
| Compound Name | (3,5-dimethylidene-4-phenylhepta-1,6-dien-4-yl)benzene |
|---|---|
| PubChem CID | 155685834 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (3,5-dimethylidene-4-phenylhepta-1,6-dien-4-yl)benzene |
| SMILES | C=CC(=C)C(C(=C)C=C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20/c1-5-17(3)21(18(4)6-2,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h5-16H,1-4H2 |
| InChIKey | FJFDAPIVNHNXPO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|