About ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene
ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene (PubChem CID 144915066) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene.
Molecular Properties
| Compound Name | ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene |
| PubChem CID | 144915066 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene |
| SMILES | C=C/C=C\C(=C)C(C)(C)c1ccccc1.CC |
| InChI | InChI=1S/C15H18.C2H6/c1-5-6-10-13(2)15(3,4)14-11-8-7-9-12-14;1-2/h5-12H,1-2H2,3-4H3;1-2H3/b10-6-; |
| InChIKey | CSTSJFOVNLSVFY-OTUCAILMSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene?
The IUPAC name of ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene (CID 144915066) is ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene.
What is the SMILES notation for ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene?
The canonical SMILES for ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene is C=C/C=C\C(=C)C(C)(C)c1ccccc1.CC.
What is the InChIKey of ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene?
The InChIKey is CSTSJFOVNLSVFY-OTUCAILMSA-N. The full InChI is InChI=1S/C15H18.C2H6/c1-5-6-10-13(2)15(3,4)14-11-8-7-9-12-14;1-2/h5-12H,1-2H2,3-4H3;1-2H3/b10-6-;.
What are the key properties of ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene?
ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene has a molecular weight of 228.38 g/mol, XLogP of 5.29, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene is sourced from PubChem (CID 144915066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).