C17H24 — CID 144915066
ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene (PubChem CID 144915066) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene.
| Compound Name | ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene |
|---|---|
| PubChem CID | 144915066 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethane;[(4Z)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]benzene |
| SMILES | C=C/C=C\C(=C)C(C)(C)c1ccccc1.CC |
| InChI | InChI=1S/C15H18.C2H6/c1-5-6-10-13(2)15(3,4)14-11-8-7-9-12-14;1-2/h5-12H,1-2H2,3-4H3;1-2H3/b10-6-; |
| InChIKey | CSTSJFOVNLSVFY-OTUCAILMSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|