C24H37NO — CID 156877846
(4Z)-2-methyl-N-(3-methylbutyl)-3-methylidene-2-phenylhepta-4,6-dienamide;2-methylpropane (PubChem CID 156877846) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (4Z)-2-methyl-N-(3-methylbutyl)-3-methylidene-2-phenylhepta-4,6-dienamide;2-methylpropane.
| Compound Name | (4Z)-2-methyl-N-(3-methylbutyl)-3-methylidene-2-phenylhepta-4,6-dienamide;2-methylpropane |
|---|---|
| PubChem CID | 156877846 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (4Z)-2-methyl-N-(3-methylbutyl)-3-methylidene-2-phenylhepta-4,6-dienamide;2-methylpropane |
| SMILES | C=C/C=C\C(=C)C(C)(C(=O)NCCC(C)C)c1ccccc1.CC(C)C |
| InChI | InChI=1S/C20H27NO.C4H10/c1-6-7-11-17(4)20(5,18-12-9-8-10-13-18)19(22)21-15-14-16(2)3;1-4(2)3/h6-13,16H,1,4,14-15H2,2-3,5H3,(H,21,22);4H,1-3H3/b11-7-; |
| InChIKey | YRVLSDODTZIWGM-AJULUCINSA-N |
| XLogP | 6.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|