C16H14F6 — CID 126625678
[(3E,4Z)-3-ethylidene-1,1,1-trifluoro-2-(trifluoromethyl)hepta-4,6-dien-2-yl]benzene (PubChem CID 126625678) has the molecular formula C16H14F6 and a molecular weight of 320.28 g/mol. Its IUPAC name is [(3E,4Z)-3-ethylidene-1,1,1-trifluoro-2-(trifluoromethyl)hepta-4,6-dien-2-yl]benzene.
| Compound Name | [(3E,4Z)-3-ethylidene-1,1,1-trifluoro-2-(trifluoromethyl)hepta-4,6-dien-2-yl]benzene |
|---|---|
| PubChem CID | 126625678 |
| Molecular Formula | C16H14F6 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(3E,4Z)-3-ethylidene-1,1,1-trifluoro-2-(trifluoromethyl)hepta-4,6-dien-2-yl]benzene |
| SMILES | C=C/C=C\C(=C/C)C(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F6/c1-3-5-9-12(4-2)14(15(17,18)19,16(20,21)22)13-10-7-6-8-11-13/h3-11H,1H2,2H3/b9-5-,12-4+ |
| InChIKey | QDEFMKJTJHFFFK-WQPWRAGBSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|