C20H26F6S — CID 143899339
ethane;(3Z,5E)-5-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)hepta-1,3,5-triene-2-thiol (PubChem CID 143899339) has the molecular formula C20H26F6S and a molecular weight of 412.48 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)hepta-1,3,5-triene-2-thiol.
| Compound Name | ethane;(3Z,5E)-5-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)hepta-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 143899339 |
| Molecular Formula | C20H26F6S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | ethane;(3Z,5E)-5-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)hepta-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C(=C/C)C(c1ccccc1)(C(F)(F)F)C(F)(F)F.CC.CC |
| InChI | InChI=1S/C16H14F6S.2C2H6/c1-3-12(10-9-11(2)23)14(15(17,18)19,16(20,21)22)13-7-5-4-6-8-13;2*1-2/h3-10,23H,2H2,1H3;2*1-2H3/b10-9-,12-3+;; |
| InChIKey | XAPNXNYLEAFIDP-DAMSXLNMSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|