C11H11F3O — CID 169226625
(E)-5,5,5-trifluoro-2-phenylpent-3-en-2-ol (PubChem CID 169226625) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-2-phenylpent-3-en-2-ol.
| Compound Name | (E)-5,5,5-trifluoro-2-phenylpent-3-en-2-ol |
|---|---|
| PubChem CID | 169226625 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (E)-5,5,5-trifluoro-2-phenylpent-3-en-2-ol |
| SMILES | CC(O)(/C=C/C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H11F3O/c1-10(15,7-8-11(12,13)14)9-5-3-2-4-6-9/h2-8,15H,1H3/b8-7+ |
| InChIKey | YGVUGEMVTFDWSS-BQYQJAHWSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|