C11H9F3O — CID 4084211
5,5,5-trifluoro-2-phenylpent-3-yn-2-ol (PubChem CID 4084211) has the molecular formula C11H9F3O and a molecular weight of 214.19 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-phenylpent-3-yn-2-ol.
| Compound Name | 5,5,5-trifluoro-2-phenylpent-3-yn-2-ol |
|---|---|
| PubChem CID | 4084211 |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 5,5,5-trifluoro-2-phenylpent-3-yn-2-ol |
| SMILES | CC(O)(C#CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H9F3O/c1-10(15,7-8-11(12,13)14)9-5-3-2-4-6-9/h2-6,15H,1H3 |
| InChIKey | LEAINCJNUNDQPD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|