C16H11F3O — CID 146003785
2-phenyl-4-(3,4,5-trifluorophenyl)but-3-yn-2-ol (PubChem CID 146003785) has the molecular formula C16H11F3O and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-phenyl-4-(3,4,5-trifluorophenyl)but-3-yn-2-ol.
| Compound Name | 2-phenyl-4-(3,4,5-trifluorophenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 146003785 |
| Molecular Formula | C16H11F3O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-phenyl-4-(3,4,5-trifluorophenyl)but-3-yn-2-ol |
| SMILES | CC(O)(C#Cc1cc(F)c(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C16H11F3O/c1-16(20,12-5-3-2-4-6-12)8-7-11-9-13(17)15(19)14(18)10-11/h2-6,9-10,20H,1H3 |
| InChIKey | CYAYTXLVKHFWEU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|