C27H21ClO — CID 141324529
4-[8-(4-chlorophenyl)-6-methylnaphthalen-2-yl]-2-phenylbut-3-yn-2-ol (PubChem CID 141324529) has the molecular formula C27H21ClO and a molecular weight of 396.92 g/mol. Its IUPAC name is 4-[8-(4-chlorophenyl)-6-methylnaphthalen-2-yl]-2-phenylbut-3-yn-2-ol.
| Compound Name | 4-[8-(4-chlorophenyl)-6-methylnaphthalen-2-yl]-2-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 141324529 |
| Molecular Formula | C27H21ClO |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[8-(4-chlorophenyl)-6-methylnaphthalen-2-yl]-2-phenylbut-3-yn-2-ol |
| SMILES | Cc1cc(-c2ccc(Cl)cc2)c2cc(C#CC(C)(O)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C27H21ClO/c1-19-16-22-9-8-20(14-15-27(2,29)23-6-4-3-5-7-23)18-26(22)25(17-19)21-10-12-24(28)13-11-21/h3-13,16-18,29H,1-2H3 |
| InChIKey | KMQSMVSQPVIMLZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|