C32H28O2Pt — CID 11061246
bis(2,4-diphenylbut-3-yn-2-ol);platinum (PubChem CID 11061246) has the molecular formula C32H28O2Pt and a molecular weight of 639.65 g/mol. Its IUPAC name is bis(2,4-diphenylbut-3-yn-2-ol);platinum.
| Compound Name | bis(2,4-diphenylbut-3-yn-2-ol);platinum |
|---|---|
| PubChem CID | 11061246 |
| Molecular Formula | C32H28O2Pt |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | bis(2,4-diphenylbut-3-yn-2-ol);platinum |
| SMILES | CC(O)(C#Cc1ccccc1)c1ccccc1.CC(O)(C#Cc1ccccc1)c1ccccc1.[Pt] |
| InChI | InChI=1S/2C16H14O.Pt/c2*1-16(17,15-10-6-3-7-11-15)13-12-14-8-4-2-5-9-14;/h2*2-11,17H,1H3; |
| InChIKey | SKPUNABNYJOYEK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|