C10H12F3O4P — CID 102046247
1-dimethoxyphosphoryl-2,2,2-trifluoro-1-phenylethanol (PubChem CID 102046247) has the molecular formula C10H12F3O4P and a molecular weight of 284.17 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-2,2,2-trifluoro-1-phenylethanol.
| Compound Name | 1-dimethoxyphosphoryl-2,2,2-trifluoro-1-phenylethanol |
|---|---|
| PubChem CID | 102046247 |
| Molecular Formula | C10H12F3O4P |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-dimethoxyphosphoryl-2,2,2-trifluoro-1-phenylethanol |
| SMILES | COP(=O)(OC)C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3O4P/c1-16-18(15,17-2)9(14,10(11,12)13)8-6-4-3-5-7-8/h3-7,14H,1-2H3 |
| InChIKey | AOEDQRIPVDHROI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|