C10H9F3O3 — CID 3841925
methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate (PubChem CID 3841925) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 3841925 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate |
| SMILES | COC(=O)C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O3/c1-16-8(14)9(15,10(11,12)13)7-5-3-2-4-6-7/h2-6,15H,1H3 |
| InChIKey | ZMXHAWAEEZLZQL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |