methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate

C10H9F3O3 — CID 3841925

IUPACmethyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate
SMILESCOC(=O)C(O)(c1ccccc1)C(F)(F)F
InChIInChI=1S/C10H9F3O3/c1-16-8(14)9(15,10(11,12)13)7-5-3-2-4-6-7/h2-6,15H,1H3
InChIKeyZMXHAWAEEZLZQL-UHFFFAOYSA-N
MW234.17 g/mol
LogP1.61
Rot. Bonds2

About methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate

methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate (PubChem CID 3841925) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate.

Molecular Properties

Compound Namemethyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate
PubChem CID3841925
Molecular FormulaC10H9F3O3
Molecular Weight234.17 g/mol
Exact Mass234.05
IUPAC Namemethyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate
SMILESCOC(=O)C(O)(c1ccccc1)C(F)(F)F
InChIInChI=1S/C10H9F3O3/c1-16-8(14)9(15,10(11,12)13)7-5-3-2-4-6-7/h2-6,15H,1H3
InChIKeyZMXHAWAEEZLZQL-UHFFFAOYSA-N
XLogP1.61
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.17
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate?
The IUPAC name of methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate (CID 3841925) is methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate.
What is the SMILES notation for methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate?
The canonical SMILES for methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate is COC(=O)C(O)(c1ccccc1)C(F)(F)F.
What is the InChIKey of methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate?
The InChIKey is ZMXHAWAEEZLZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O3/c1-16-8(14)9(15,10(11,12)13)7-5-3-2-4-6-7/h2-6,15H,1H3.
What are the key properties of methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate?
methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate has a molecular weight of 234.17 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoate is sourced from PubChem (CID 3841925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).