C19H14F3NO5 — CID 7201050
methyl (2R)-2-[4-(1,3-dioxoisoindol-2-yl)-3-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 7201050) has the molecular formula C19H14F3NO5 and a molecular weight of 393.32 g/mol. Its IUPAC name is methyl (2R)-2-[4-(1,3-dioxoisoindol-2-yl)-3-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[4-(1,3-dioxoisoindol-2-yl)-3-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 7201050 |
| Molecular Formula | C19H14F3NO5 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | methyl (2R)-2-[4-(1,3-dioxoisoindol-2-yl)-3-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | COC(=O)[C@](O)(c1ccc(N2C(=O)c3ccccc3C2=O)c(C)c1)C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO5/c1-10-9-11(18(27,17(26)28-2)19(20,21)22)7-8-14(10)23-15(24)12-5-3-4-6-13(12)16(23)25/h3-9,27H,1-2H3/t18-/m1/s1 |
| InChIKey | CWOCHOGPSNJOLL-GOSISDBHSA-N |
| XLogP | 2.72 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|