C16H12F4O2 — CID 98040440
methyl (2S)-2,3,3,3-tetrafluoro-2-(4-phenylphenyl)propanoate (PubChem CID 98040440) has the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. Its IUPAC name is methyl (2S)-2,3,3,3-tetrafluoro-2-(4-phenylphenyl)propanoate.
| Compound Name | methyl (2S)-2,3,3,3-tetrafluoro-2-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 98040440 |
| Molecular Formula | C16H12F4O2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methyl (2S)-2,3,3,3-tetrafluoro-2-(4-phenylphenyl)propanoate |
| SMILES | COC(=O)[C@@](F)(c1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H12F4O2/c1-22-14(21)15(17,16(18,19)20)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3/t15-/m0/s1 |
| InChIKey | XWNZNFPGTHXSOE-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |