C10H7BrF4O2 — CID 125050386
methyl (2S)-2-(3-bromophenyl)-2,3,3,3-tetrafluoropropanoate (PubChem CID 125050386) has the molecular formula C10H7BrF4O2 and a molecular weight of 315.06 g/mol. Its IUPAC name is methyl (2S)-2-(3-bromophenyl)-2,3,3,3-tetrafluoropropanoate.
| Compound Name | methyl (2S)-2-(3-bromophenyl)-2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 125050386 |
| Molecular Formula | C10H7BrF4O2 |
| Molecular Weight | 315.06 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | methyl (2S)-2-(3-bromophenyl)-2,3,3,3-tetrafluoropropanoate |
| SMILES | COC(=O)[C@@](F)(c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C10H7BrF4O2/c1-17-8(16)9(12,10(13,14)15)6-3-2-4-7(11)5-6/h2-5H,1H3/t9-/m0/s1 |
| InChIKey | YOQHFXWQMFFHIH-VIFPVBQESA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.06 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |