C22H25BrF2O3 — CID 171076715
methyl 2-(3-bromophenyl)-5,5-difluoro-2-methyl-7-phenylmethoxyheptanoate (PubChem CID 171076715) has the molecular formula C22H25BrF2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-5,5-difluoro-2-methyl-7-phenylmethoxyheptanoate.
| Compound Name | methyl 2-(3-bromophenyl)-5,5-difluoro-2-methyl-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 171076715 |
| Molecular Formula | C22H25BrF2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | methyl 2-(3-bromophenyl)-5,5-difluoro-2-methyl-7-phenylmethoxyheptanoate |
| SMILES | COC(=O)C(C)(CCC(F)(F)CCOCc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H25BrF2O3/c1-21(20(26)27-2,18-9-6-10-19(23)15-18)11-12-22(24,25)13-14-28-16-17-7-4-3-5-8-17/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | JNAUWINLQMNDOJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|