C19H27BrN2O2 — CID 171079543
methyl 8-amino-2-(3-bromophenyl)-8-cyano-2,7,7-trimethyloctanoate (PubChem CID 171079543) has the molecular formula C19H27BrN2O2 and a molecular weight of 395.34 g/mol. Its IUPAC name is methyl 8-amino-2-(3-bromophenyl)-8-cyano-2,7,7-trimethyloctanoate.
| Compound Name | methyl 8-amino-2-(3-bromophenyl)-8-cyano-2,7,7-trimethyloctanoate |
|---|---|
| PubChem CID | 171079543 |
| Molecular Formula | C19H27BrN2O2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | methyl 8-amino-2-(3-bromophenyl)-8-cyano-2,7,7-trimethyloctanoate |
| SMILES | COC(=O)C(C)(CCCCC(C)(C)C(N)C#N)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H27BrN2O2/c1-18(2,16(22)13-21)10-5-6-11-19(3,17(23)24-4)14-8-7-9-15(20)12-14/h7-9,12,16H,5-6,10-11,22H2,1-4H3 |
| InChIKey | NIEYTVRBRORRIF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|