C18H27BrO3 — CID 171077988
methyl 9-bromo-8-hydroxy-2-methyl-2-(3-methylphenyl)nonanoate (PubChem CID 171077988) has the molecular formula C18H27BrO3 and a molecular weight of 371.32 g/mol. Its IUPAC name is methyl 9-bromo-8-hydroxy-2-methyl-2-(3-methylphenyl)nonanoate.
| Compound Name | methyl 9-bromo-8-hydroxy-2-methyl-2-(3-methylphenyl)nonanoate |
|---|---|
| PubChem CID | 171077988 |
| Molecular Formula | C18H27BrO3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl 9-bromo-8-hydroxy-2-methyl-2-(3-methylphenyl)nonanoate |
| SMILES | COC(=O)C(C)(CCCCCC(O)CBr)c1cccc(C)c1 |
| InChI | InChI=1S/C18H27BrO3/c1-14-8-7-9-15(12-14)18(2,17(21)22-3)11-6-4-5-10-16(20)13-19/h7-9,12,16,20H,4-6,10-11,13H2,1-3H3 |
| InChIKey | YVCBJHZJRIZGNT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|