C21H34O3 — CID 171079802
ethane;methyl 2,7,7-trimethyl-2-(3-methylphenyl)-8-oxooctanoate (PubChem CID 171079802) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethane;methyl 2,7,7-trimethyl-2-(3-methylphenyl)-8-oxooctanoate.
| Compound Name | ethane;methyl 2,7,7-trimethyl-2-(3-methylphenyl)-8-oxooctanoate |
|---|---|
| PubChem CID | 171079802 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | ethane;methyl 2,7,7-trimethyl-2-(3-methylphenyl)-8-oxooctanoate |
| SMILES | CC.COC(=O)C(C)(CCCCC(C)(C)C=O)c1cccc(C)c1 |
| InChI | InChI=1S/C19H28O3.C2H6/c1-15-9-8-10-16(13-15)19(4,17(21)22-5)12-7-6-11-18(2,3)14-20;1-2/h8-10,13-14H,6-7,11-12H2,1-5H3;1-2H3 |
| InChIKey | SSVOVSVDHABTKW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|