C19H28O2 — CID 171079377
ethane;methyl 2-methyl-2-(3-methylphenyl)oct-7-ynoate (PubChem CID 171079377) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is ethane;methyl 2-methyl-2-(3-methylphenyl)oct-7-ynoate.
| Compound Name | ethane;methyl 2-methyl-2-(3-methylphenyl)oct-7-ynoate |
|---|---|
| PubChem CID | 171079377 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | ethane;methyl 2-methyl-2-(3-methylphenyl)oct-7-ynoate |
| SMILES | C#CCCCCC(C)(C(=O)OC)c1cccc(C)c1.CC |
| InChI | InChI=1S/C17H22O2.C2H6/c1-5-6-7-8-12-17(3,16(18)19-4)15-11-9-10-14(2)13-15;1-2/h1,9-11,13H,6-8,12H2,2-4H3;1-2H3 |
| InChIKey | RGFQBPWMMPPGDU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|