C20H27BrO — CID 171078953
1-bromo-3,7,7-trimethyl-3-(3-methylphenyl)dec-9-yn-2-one (PubChem CID 171078953) has the molecular formula C20H27BrO and a molecular weight of 363.34 g/mol. Its IUPAC name is 1-bromo-3,7,7-trimethyl-3-(3-methylphenyl)dec-9-yn-2-one.
| Compound Name | 1-bromo-3,7,7-trimethyl-3-(3-methylphenyl)dec-9-yn-2-one |
|---|---|
| PubChem CID | 171078953 |
| Molecular Formula | C20H27BrO |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-bromo-3,7,7-trimethyl-3-(3-methylphenyl)dec-9-yn-2-one |
| SMILES | C#CCC(C)(C)CCCC(C)(C(=O)CBr)c1cccc(C)c1 |
| InChI | InChI=1S/C20H27BrO/c1-6-11-19(3,4)12-8-13-20(5,18(22)15-21)17-10-7-9-16(2)14-17/h1,7,9-10,14H,8,11-13,15H2,2-5H3 |
| InChIKey | OYGDZYIPYVTVKK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|