C18H23BrINO — CID 171078454
9-bromo-7-(3-iodophenyl)-2,2,7-trimethyl-8-oxononanenitrile (PubChem CID 171078454) has the molecular formula C18H23BrINO and a molecular weight of 476.20 g/mol. Its IUPAC name is 9-bromo-7-(3-iodophenyl)-2,2,7-trimethyl-8-oxononanenitrile.
| Compound Name | 9-bromo-7-(3-iodophenyl)-2,2,7-trimethyl-8-oxononanenitrile |
|---|---|
| PubChem CID | 171078454 |
| Molecular Formula | C18H23BrINO |
| Molecular Weight | 476.20 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | 9-bromo-7-(3-iodophenyl)-2,2,7-trimethyl-8-oxononanenitrile |
| SMILES | CC(C)(C#N)CCCCC(C)(C(=O)CBr)c1cccc(I)c1 |
| InChI | InChI=1S/C18H23BrINO/c1-17(2,13-21)9-4-5-10-18(3,16(22)12-19)14-7-6-8-15(20)11-14/h6-8,11H,4-5,9-10,12H2,1-3H3 |
| InChIKey | ZVSWUOZLICDNOO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.20 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|