C22H35IO3S — CID 171077016
tert-butyl 7-(2-hydroxyethylsulfanyl)-2-(3-iodophenyl)-2,6,6-trimethylheptanoate (PubChem CID 171077016) has the molecular formula C22H35IO3S and a molecular weight of 506.49 g/mol. Its IUPAC name is tert-butyl 7-(2-hydroxyethylsulfanyl)-2-(3-iodophenyl)-2,6,6-trimethylheptanoate.
| Compound Name | tert-butyl 7-(2-hydroxyethylsulfanyl)-2-(3-iodophenyl)-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 171077016 |
| Molecular Formula | C22H35IO3S |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | tert-butyl 7-(2-hydroxyethylsulfanyl)-2-(3-iodophenyl)-2,6,6-trimethylheptanoate |
| SMILES | CC(C)(CCCC(C)(C(=O)OC(C)(C)C)c1cccc(I)c1)CSCCO |
| InChI | InChI=1S/C22H35IO3S/c1-20(2,3)26-19(25)22(6,17-9-7-10-18(23)15-17)12-8-11-21(4,5)16-27-14-13-24/h7,9-10,15,24H,8,11-14,16H2,1-6H3 |
| InChIKey | IDTOBAWRDYWRIT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|