C29H50N2O5S — CID 171076081
tert-butyl N-[[7-(2-hydroxyethylsulfanyl)-2-[3-(3-methoxy-2-methylpropyl)phenyl]-2,6,6-trimethylheptanoyl]amino]-N-methylcarbamate (PubChem CID 171076081) has the molecular formula C29H50N2O5S and a molecular weight of 538.80 g/mol. Its IUPAC name is tert-butyl N-[[7-(2-hydroxyethylsulfanyl)-2-[3-(3-methoxy-2-methylpropyl)phenyl]-2,6,6-trimethylheptanoyl]amino]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[7-(2-hydroxyethylsulfanyl)-2-[3-(3-methoxy-2-methylpropyl)phenyl]-2,6,6-trimethylheptanoyl]amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 171076081 |
| Molecular Formula | C29H50N2O5S |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | tert-butyl N-[[7-(2-hydroxyethylsulfanyl)-2-[3-(3-methoxy-2-methylpropyl)phenyl]-2,6,6-trimethylheptanoyl]amino]-N-methylcarbamate |
| SMILES | COCC(C)Cc1cccc(C(C)(CCCC(C)(C)CSCCO)C(=O)NN(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C29H50N2O5S/c1-22(20-35-9)18-23-12-10-13-24(19-23)29(7,15-11-14-28(5,6)21-37-17-16-32)25(33)30-31(8)26(34)36-27(2,3)4/h10,12-13,19,22,32H,11,14-18,20-21H2,1-9H3,(H,30,33) |
| InChIKey | CURAYOKOCJZPPL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|