C25H40N2O5S — CID 171076297
ethyl 2-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-2,6,6-trimethyl-1-(2-methylhydrazinyl)-1-oxoheptan-2-yl]phenyl]acetate (PubChem CID 171076297) has the molecular formula C25H40N2O5S and a molecular weight of 480.67 g/mol. Its IUPAC name is ethyl 2-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-2,6,6-trimethyl-1-(2-methylhydrazinyl)-1-oxoheptan-2-yl]phenyl]acetate.
| Compound Name | ethyl 2-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-2,6,6-trimethyl-1-(2-methylhydrazinyl)-1-oxoheptan-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 171076297 |
| Molecular Formula | C25H40N2O5S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | ethyl 2-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-2,6,6-trimethyl-1-(2-methylhydrazinyl)-1-oxoheptan-2-yl]phenyl]acetate |
| SMILES | CCOC(=O)CSCC(C)(C)CCCC(C)(C(=O)NNC)c1cccc(CC(=O)OCC)c1 |
| InChI | InChI=1S/C25H40N2O5S/c1-7-31-21(28)16-19-11-9-12-20(15-19)25(5,23(30)27-26-6)14-10-13-24(3,4)18-33-17-22(29)32-8-2/h9,11-12,15,26H,7-8,10,13-14,16-18H2,1-6H3,(H,27,30) |
| InChIKey | NOQURCRUYIQSJM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|