C26H42N2O5S — CID 171077422
ethyl 3-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-1-(2-ethylhydrazinyl)-6,6-dimethyl-1-oxoheptan-2-yl]phenyl]propanoate (PubChem CID 171077422) has the molecular formula C26H42N2O5S and a molecular weight of 494.70 g/mol. Its IUPAC name is ethyl 3-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-1-(2-ethylhydrazinyl)-6,6-dimethyl-1-oxoheptan-2-yl]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-1-(2-ethylhydrazinyl)-6,6-dimethyl-1-oxoheptan-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 171077422 |
| Molecular Formula | C26H42N2O5S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | ethyl 3-[3-[7-(2-ethoxy-2-oxoethyl)sulfanyl-1-(2-ethylhydrazinyl)-6,6-dimethyl-1-oxoheptan-2-yl]phenyl]propanoate |
| SMILES | CCNNC(=O)C(CCCC(C)(C)CSCC(=O)OCC)c1cccc(CCC(=O)OCC)c1 |
| InChI | InChI=1S/C26H42N2O5S/c1-6-27-28-25(31)22(13-10-16-26(4,5)19-34-18-24(30)33-8-3)21-12-9-11-20(17-21)14-15-23(29)32-7-2/h9,11-12,17,22,27H,6-8,10,13-16,18-19H2,1-5H3,(H,28,31) |
| InChIKey | TYRBFTZDMMGFHZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|