C15H20O6 — CID 171897946
3-[3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]propanoic acid (PubChem CID 171897946) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]propanoic acid.
| Compound Name | 3-[3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 171897946 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-[3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]propanoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C15H20O6/c1-2-21-14(19)9-12(16)15(20)11-5-3-4-10(8-11)6-7-13(17)18/h3-5,8,12,15-16,20H,2,6-7,9H2,1H3,(H,17,18) |
| InChIKey | UWUBQJDYHLZAOW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |