C13H17NO4S — CID 171897396
ethyl 4-(3-carbamothioylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171897396) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is ethyl 4-(3-carbamothioylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(3-carbamothioylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897396 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | ethyl 4-(3-carbamothioylphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C13H17NO4S/c1-2-18-11(16)7-10(15)12(17)8-4-3-5-9(6-8)13(14)19/h3-6,10,12,15,17H,2,7H2,1H3,(H2,14,19) |
| InChIKey | OUXROKAFAKINEG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|