C16H24N2O4 — CID 171898198
ethyl 3,4-dihydroxy-4-(3-piperazin-1-ylphenyl)butanoate (PubChem CID 171898198) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(3-piperazin-1-ylphenyl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(3-piperazin-1-ylphenyl)butanoate |
|---|---|
| PubChem CID | 171898198 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(3-piperazin-1-ylphenyl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cccc(N2CCNCC2)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-2-22-15(20)11-14(19)16(21)12-4-3-5-13(10-12)18-8-6-17-7-9-18/h3-5,10,14,16-17,19,21H,2,6-9,11H2,1H3 |
| InChIKey | MEZWQYUFBMBJAB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |