C12H15NO5 — CID 171899481
2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid (PubChem CID 171899481) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid.
| Compound Name | 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 171899481 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid |
| SMILES | NC(=O)CC(O)C(O)c1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C12H15NO5/c13-10(15)6-9(14)12(18)8-3-1-2-7(4-8)5-11(16)17/h1-4,9,12,14,18H,5-6H2,(H2,13,15)(H,16,17) |
| InChIKey | KKACNXVRYSWJEC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |