C13H17NO5 — CID 171899743
methyl 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetate (PubChem CID 171899743) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetate.
| Compound Name | methyl 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetate |
|---|---|
| PubChem CID | 171899743 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 2-[3-(4-amino-1,2-dihydroxy-4-oxobutyl)phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C(O)C(O)CC(N)=O)c1 |
| InChI | InChI=1S/C13H17NO5/c1-19-12(17)6-8-3-2-4-9(5-8)13(18)10(15)7-11(14)16/h2-5,10,13,15,18H,6-7H2,1H3,(H2,14,16) |
| InChIKey | QRUWATIKBFRCRO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |