C13H17N3O4 — CID 171880034
methyl 2-[3-(4-azido-1,2-dihydroxybutyl)phenyl]acetate (PubChem CID 171880034) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 2-[3-(4-azido-1,2-dihydroxybutyl)phenyl]acetate.
| Compound Name | methyl 2-[3-(4-azido-1,2-dihydroxybutyl)phenyl]acetate |
|---|---|
| PubChem CID | 171880034 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl 2-[3-(4-azido-1,2-dihydroxybutyl)phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C(O)C(O)CCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C13H17N3O4/c1-20-12(18)8-9-3-2-4-10(7-9)13(19)11(17)5-6-15-16-14/h2-4,7,11,13,17,19H,5-6,8H2,1H3 |
| InChIKey | KHLDMQLGFRALLB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|