C18H28O3S — CID 171076285
7-(2-hydroxyethylsulfanyl)-6,6-dimethyl-2-(3-methylphenyl)heptanoic acid (PubChem CID 171076285) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is 7-(2-hydroxyethylsulfanyl)-6,6-dimethyl-2-(3-methylphenyl)heptanoic acid.
| Compound Name | 7-(2-hydroxyethylsulfanyl)-6,6-dimethyl-2-(3-methylphenyl)heptanoic acid |
|---|---|
| PubChem CID | 171076285 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 7-(2-hydroxyethylsulfanyl)-6,6-dimethyl-2-(3-methylphenyl)heptanoic acid |
| SMILES | Cc1cccc(C(CCCC(C)(C)CSCCO)C(=O)O)c1 |
| InChI | InChI=1S/C18H28O3S/c1-14-6-4-7-15(12-14)16(17(20)21)8-5-9-18(2,3)13-22-11-10-19/h4,6-7,12,16,19H,5,8-11,13H2,1-3H3,(H,20,21) |
| InChIKey | KGJRUBCCNLUMGK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|