C14H17F3O3 — CID 79437094
2-(3-methylphenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 79437094) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-(3-methylphenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid.
| Compound Name | 2-(3-methylphenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
|---|---|
| PubChem CID | 79437094 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(3-methylphenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
| SMILES | Cc1cccc(C(CCCOCC(F)(F)F)C(=O)O)c1 |
| InChI | InChI=1S/C14H17F3O3/c1-10-4-2-5-11(8-10)12(13(18)19)6-3-7-20-9-14(15,16)17/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,18,19) |
| InChIKey | BYUCDJFFBUJWNK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|