About 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid
7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid (PubChem CID 171076591) has the molecular formula C24H36O6S
and a molecular weight of 452.61 g/mol. Its IUPAC name is 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid.
Molecular Properties
| Compound Name | 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid |
| PubChem CID | 171076591 |
| Molecular Formula | C24H36O6S |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid |
| SMILES | CCOC(=O)CCc1cccc(C(CCCC(C)(C)CSCC(=O)OCC)C(=O)O)c1 |
| InChI | InChI=1S/C24H36O6S/c1-5-29-21(25)13-12-18-9-7-10-19(15-18)20(23(27)28)11-8-14-24(3,4)17-31-16-22(26)30-6-2/h7,9-10,15,20H,5-6,8,11-14,16-17H2,1-4H3,(H,27,28) |
| InChIKey | JLYBJEQCLMAOLQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid?
The IUPAC name of 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid (CID 171076591) is 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid.
What is the SMILES notation for 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid?
The canonical SMILES for 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid is CCOC(=O)CCc1cccc(C(CCCC(C)(C)CSCC(=O)OCC)C(=O)O)c1.
What is the InChIKey of 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid?
The InChIKey is JLYBJEQCLMAOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36O6S/c1-5-29-21(25)13-12-18-9-7-10-19(15-18)20(23(27)28)11-8-14-24(3,4)17-31-16-22(26)30-6-2/h7,9-10,15,20H,5-6,8,11-14,16-17H2,1-4H3,(H,27,28).
What are the key properties of 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid?
7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid has a molecular weight of 452.61 g/mol, XLogP of 4.84, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-ethoxy-2-oxoethyl)sulfanyl-2-[3-(3-ethoxy-3-oxopropyl)phenyl]-6,6-dimethylheptanoic acid is sourced from PubChem (CID 171076591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).