C29H40O5 — CID 171077411
benzyl 2-[3-(3-ethoxy-3-oxopropyl)phenyl]-8-hydroxy-2,7,7-trimethyloctanoate (PubChem CID 171077411) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is benzyl 2-[3-(3-ethoxy-3-oxopropyl)phenyl]-8-hydroxy-2,7,7-trimethyloctanoate.
| Compound Name | benzyl 2-[3-(3-ethoxy-3-oxopropyl)phenyl]-8-hydroxy-2,7,7-trimethyloctanoate |
|---|---|
| PubChem CID | 171077411 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | benzyl 2-[3-(3-ethoxy-3-oxopropyl)phenyl]-8-hydroxy-2,7,7-trimethyloctanoate |
| SMILES | CCOC(=O)CCc1cccc(C(C)(CCCCC(C)(C)CO)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H40O5/c1-5-33-26(31)17-16-23-14-11-15-25(20-23)29(4,19-10-9-18-28(2,3)22-30)27(32)34-21-24-12-7-6-8-13-24/h6-8,11-15,20,30H,5,9-10,16-19,21-22H2,1-4H3 |
| InChIKey | ANZOIHOYLOLSBR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|