C24H38O6 — CID 176798709
butyl 2-[3-(2-ethoxy-2-oxoethoxy)phenyl]-7-hydroxy-2,6,6-trimethylheptanoate (PubChem CID 176798709) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is butyl 2-[3-(2-ethoxy-2-oxoethoxy)phenyl]-7-hydroxy-2,6,6-trimethylheptanoate.
| Compound Name | butyl 2-[3-(2-ethoxy-2-oxoethoxy)phenyl]-7-hydroxy-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 176798709 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | butyl 2-[3-(2-ethoxy-2-oxoethoxy)phenyl]-7-hydroxy-2,6,6-trimethylheptanoate |
| SMILES | CCCCOC(=O)C(C)(CCCC(C)(C)CO)c1cccc(OCC(=O)OCC)c1 |
| InChI | InChI=1S/C24H38O6/c1-6-8-15-29-22(27)24(5,14-10-13-23(3,4)18-25)19-11-9-12-20(16-19)30-17-21(26)28-7-2/h9,11-12,16,25H,6-8,10,13-15,17-18H2,1-5H3 |
| InChIKey | FGBUGCPOESTRJC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|