C32H38INO4 — CID 176798952
benzyl (2R)-2-(3-iodophenyl)-2,6,6-trimethyl-7-[methyl(phenylmethoxycarbonyl)amino]heptanoate (PubChem CID 176798952) has the molecular formula C32H38INO4 and a molecular weight of 627.56 g/mol. Its IUPAC name is benzyl (2R)-2-(3-iodophenyl)-2,6,6-trimethyl-7-[methyl(phenylmethoxycarbonyl)amino]heptanoate.
| Compound Name | benzyl (2R)-2-(3-iodophenyl)-2,6,6-trimethyl-7-[methyl(phenylmethoxycarbonyl)amino]heptanoate |
|---|---|
| PubChem CID | 176798952 |
| Molecular Formula | C32H38INO4 |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | benzyl (2R)-2-(3-iodophenyl)-2,6,6-trimethyl-7-[methyl(phenylmethoxycarbonyl)amino]heptanoate |
| SMILES | CN(CC(C)(C)CCC[C@@](C)(C(=O)OCc1ccccc1)c1cccc(I)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H38INO4/c1-31(2,24-34(4)30(36)38-23-26-15-9-6-10-16-26)19-12-20-32(3,27-17-11-18-28(33)21-27)29(35)37-22-25-13-7-5-8-14-25/h5-11,13-18,21H,12,19-20,22-24H2,1-4H3/t32-/m1/s1 |
| InChIKey | AMUBYZXNPSNDIJ-JGCGQSQUSA-N |
| XLogP | 7.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|