C23H27ClINO5S — CID 171076338
benzyl N-[2-[5-chloro-3-(3-iodophenyl)-3-methyl-4-oxopentyl]sulfonylethyl]-N-methylcarbamate (PubChem CID 171076338) has the molecular formula C23H27ClINO5S and a molecular weight of 591.90 g/mol. Its IUPAC name is benzyl N-[2-[5-chloro-3-(3-iodophenyl)-3-methyl-4-oxopentyl]sulfonylethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[5-chloro-3-(3-iodophenyl)-3-methyl-4-oxopentyl]sulfonylethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171076338 |
| Molecular Formula | C23H27ClINO5S |
| Molecular Weight | 591.90 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | benzyl N-[2-[5-chloro-3-(3-iodophenyl)-3-methyl-4-oxopentyl]sulfonylethyl]-N-methylcarbamate |
| SMILES | CN(CCS(=O)(=O)CCC(C)(C(=O)CCl)c1cccc(I)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27ClINO5S/c1-23(21(27)16-24,19-9-6-10-20(25)15-19)11-13-32(29,30)14-12-26(2)22(28)31-17-18-7-4-3-5-8-18/h3-10,15H,11-14,16-17H2,1-2H3 |
| InChIKey | GDAKTMYEMWCVND-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|