C25H34INO4 — CID 171078512
benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylpentoxy]-2-methylpropyl]-N-methylcarbamate (PubChem CID 171078512) has the molecular formula C25H34INO4 and a molecular weight of 539.45 g/mol. Its IUPAC name is benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylpentoxy]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylpentoxy]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171078512 |
| Molecular Formula | C25H34INO4 |
| Molecular Weight | 539.45 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylpentoxy]-2-methylpropyl]-N-methylcarbamate |
| SMILES | CC(O)C(C)(CCOC(C)(C)CN(C)C(=O)OCc1ccccc1)c1cccc(I)c1 |
| InChI | InChI=1S/C25H34INO4/c1-19(28)25(4,21-12-9-13-22(26)16-21)14-15-31-24(2,3)18-27(5)23(29)30-17-20-10-7-6-8-11-20/h6-13,16,19,28H,14-15,17-18H2,1-5H3 |
| InChIKey | ZSEOQQQAOALYRI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|