C24H31NO6 — CID 146471794
3-(3-methyl-3-phenylmethoxybutoxy)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid (PubChem CID 146471794) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is 3-(3-methyl-3-phenylmethoxybutoxy)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid.
| Compound Name | 3-(3-methyl-3-phenylmethoxybutoxy)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 146471794 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 3-(3-methyl-3-phenylmethoxybutoxy)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)C(COCCC(C)(C)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H31NO6/c1-24(2,31-17-20-12-8-5-9-13-20)14-15-29-18-21(22(26)27)25(3)23(28)30-16-19-10-6-4-7-11-19/h4-13,21H,14-18H2,1-3H3,(H,26,27) |
| InChIKey | LDNRDLJXTFGSGB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|