C17H26N2O5 — CID 175532649
2-[2-aminoethyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 175532649) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-[2-aminoethyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | 2-[2-aminoethyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 175532649 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-[2-aminoethyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CC(C)(C)OCC(C(=O)O)N(CCN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O5/c1-17(2,3)24-12-14(15(20)21)19(10-9-18)16(22)23-11-13-7-5-4-6-8-13/h4-8,14H,9-12,18H2,1-3H3,(H,20,21) |
| InChIKey | HARYLMLJYFDJAE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |