C28H33NO5Si — CID 158253839
(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid (PubChem CID 158253839) has the molecular formula C28H33NO5Si and a molecular weight of 491.66 g/mol. Its IUPAC name is (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid.
| Compound Name | (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 158253839 |
| Molecular Formula | C28H33NO5Si |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H33NO5Si/c1-28(2,3)35(23-16-10-6-11-17-23,24-18-12-7-13-19-24)34-21-25(26(30)31)29(4)27(32)33-20-22-14-8-5-9-15-22/h5-19,25H,20-21H2,1-4H3,(H,30,31)/t25-/m1/s1 |
| InChIKey | FBRNXMVCUKUAMI-RUZDIDTESA-N |
| XLogP | 4.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|