C41H48N2O5Si — CID 175229042
benzyl N-[1-[tert-butyl(diphenyl)silyl]oxyhex-4-yn-2-yl]-N-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]carbamate (PubChem CID 175229042) has the molecular formula C41H48N2O5Si and a molecular weight of 676.93 g/mol. Its IUPAC name is benzyl N-[1-[tert-butyl(diphenyl)silyl]oxyhex-4-yn-2-yl]-N-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]carbamate.
| Compound Name | benzyl N-[1-[tert-butyl(diphenyl)silyl]oxyhex-4-yn-2-yl]-N-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 175229042 |
| Molecular Formula | C41H48N2O5Si |
| Molecular Weight | 676.93 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | benzyl N-[1-[tert-butyl(diphenyl)silyl]oxyhex-4-yn-2-yl]-N-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]carbamate |
| SMILES | CC#CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(CCN(C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H48N2O5Si/c1-6-7-24-36(33-48-49(41(2,3)4,37-25-16-10-17-26-37)38-27-18-11-19-28-38)43(40(45)47-32-35-22-14-9-15-23-35)30-29-42(5)39(44)46-31-34-20-12-8-13-21-34/h8-23,25-28,36H,24,29-33H2,1-5H3 |
| InChIKey | UETJOOJQAANFIF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.93 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|