C29H36FNO3Si — CID 168947827
benzyl N-[4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobutyl]-N-methylcarbamate (PubChem CID 168947827) has the molecular formula C29H36FNO3Si and a molecular weight of 493.70 g/mol. Its IUPAC name is benzyl N-[4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobutyl]-N-methylcarbamate.
| Compound Name | benzyl N-[4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168947827 |
| Molecular Formula | C29H36FNO3Si |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | benzyl N-[4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobutyl]-N-methylcarbamate |
| SMILES | CN(CC(F)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H36FNO3Si/c1-29(2,3)35(26-16-10-6-11-17-26,27-18-12-7-13-19-27)34-21-20-25(30)22-31(4)28(32)33-23-24-14-8-5-9-15-24/h5-19,25H,20-23H2,1-4H3 |
| InChIKey | HGVJKFMDYHACKP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|