C50H60N2O7Si — CID 21359594
benzyl 3-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(3-oxo-3-phenylmethoxypropyl)amino]ethyl-(3-oxo-3-phenylmethoxypropyl)amino]propanoate (PubChem CID 21359594) has the molecular formula C50H60N2O7Si and a molecular weight of 829.12 g/mol. Its IUPAC name is benzyl 3-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(3-oxo-3-phenylmethoxypropyl)amino]ethyl-(3-oxo-3-phenylmethoxypropyl)amino]propanoate.
| Compound Name | benzyl 3-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(3-oxo-3-phenylmethoxypropyl)amino]ethyl-(3-oxo-3-phenylmethoxypropyl)amino]propanoate |
|---|---|
| PubChem CID | 21359594 |
| Molecular Formula | C50H60N2O7Si |
| Molecular Weight | 829.12 g/mol |
| Exact Mass | 828.42 |
| IUPAC Name | benzyl 3-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(3-oxo-3-phenylmethoxypropyl)amino]ethyl-(3-oxo-3-phenylmethoxypropyl)amino]propanoate |
| SMILES | CC(C)(C)[Si](OCCN(CCC(=O)OCc1ccccc1)CCN(CCC(=O)OCc1ccccc1)CCC(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H60N2O7Si/c1-50(2,3)60(45-25-15-7-16-26-45,46-27-17-8-18-28-46)59-38-37-52(34-31-49(55)58-41-44-23-13-6-14-24-44)36-35-51(32-29-47(53)56-39-42-19-9-4-10-20-42)33-30-48(54)57-40-43-21-11-5-12-22-43/h4-28H,29-41H2,1-3H3 |
| InChIKey | NFGPXWBBSZJUGK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.12 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|