C34H45NO5Si — CID 123263699
benzyl 5-[tert-butyl(diphenyl)silyl]oxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate (PubChem CID 123263699) has the molecular formula C34H45NO5Si and a molecular weight of 575.82 g/mol. Its IUPAC name is benzyl 5-[tert-butyl(diphenyl)silyl]oxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate.
| Compound Name | benzyl 5-[tert-butyl(diphenyl)silyl]oxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 123263699 |
| Molecular Formula | C34H45NO5Si |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | benzyl 5-[tert-butyl(diphenyl)silyl]oxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
| SMILES | CN(C(=O)OC(C)(C)C)C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H45NO5Si/c1-33(2,3)40-32(37)35(7)30(31(36)38-26-27-18-11-8-12-19-27)24-17-25-39-41(34(4,5)6,28-20-13-9-14-21-28)29-22-15-10-16-23-29/h8-16,18-23,30H,17,24-26H2,1-7H3 |
| InChIKey | GAURFUJQUZHHCF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|